ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
56107-02-9 4-Chloro-3-nitrobenzophenone |
|
Ονομασία του προϊόντος | 4-Chloro-3-nitrobenzophenone |
Αγγλικό όνομα | 4-Chloro-3-nitrobenzophenone;(4-Chloro-3-nitrophenyl)phenylmethanone |
MF | C13H8ClNO3 |
Μοριακό βάρος | 261.6605 |
InChI | InChI=1/C13H8ClNO3/c14-11-7-6-10(8-12(11)15(17)18)13(16)9-4-2-1-3-5-9/h1-8H |
CAS ΟΧΙ | 56107-02-9 |
EINECS | 259-995-7 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.367g/cm3 |
Σημείο τήξης | 101-107℃ |
Σημείο βρασμού | 386.5°C at 760 mmHg |
Δείκτης διάθλασης | 1.623 |
Σημείο ανάφλεξης | 203.4°C |
Πίεση ατμών | 3.53E-06mmHg at 25°C |
Σύμβολα επικινδυνότητας | |
Κινδύνου Κώδικες | R20/21##Harmful by inhalation and in contact with skin.:; |
Περιγραφή της ασφάλειας | S22##Do not inhale dust.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |