ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
141-15-1 rhodinyl butyrate |
|
| termék neve | rhodinyl butyrate |
| Angol név | rhodinyl butyrate;Butanoic acid, 3,7-dimethyl-7-octen-1-yl ester;3,7-Dimethyl-7-octen-1-yl butanoate;3,7-Dimethyl-7-octen-1-yl butyrate;Butanoic acid, 3,7-dimethyl-7-octenyl ester;Butyric acid, 3,7-dimethyl-7-octenyl ester;3,7-dimethyloct-7-en-1-yl butanoate |
| MF | C14H26O2 |
| Molekulatömeg | 226.355 |
| InChI | InChI=1/C14H26O2/c1-5-7-14(15)16-11-10-13(4)9-6-8-12(2)3/h13H,2,5-11H2,1,3-4H3 |
| CAS-szám | 141-15-1 |
| EINECS | 205-462-9 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.876g/cm3 |
| Forráspont | 292.6°C at 760 mmHg |
| Törésmutató | 1.44 |
| Gyulladáspont | 91.5°C |
| Gőznyomás | 0.00181mmHg at 25°C |
| MSDS | |