ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17351-75-6 Divinyloxy 1,4-cyclohexanedimethanol |
|
| termék neve | Divinyloxy 1,4-cyclohexanedimethanol |
| Angol név | Divinyloxy 1,4-cyclohexanedimethanol;1,4-Cyclohexanedimethanol divinyl ether,mixture of isomers;1,4-bis(prop-1-en-1-yloxy)cyclohexane;3,5-bis(1-methylethyl)-1H-pyrazole;1,4-Cyclohexan dimethanol divinyl ether |
| MF | C9H16N2 |
| Molekulatömeg | 152.2367 |
| InChI | InChI=1/C9H16N2/c1-6(2)8-5-9(7(3)4)11-10-8/h5-7H,1-4H3,(H,10,11) |
| CAS-szám | 17351-75-6 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.944g/cm3 |
| Olvadáspont | 6℃ |
| Forráspont | 237.3°C at 760 mmHg |
| Törésmutató | 1.496 |
| Gyulladáspont | 91.4°C |
| Gőznyomás | 0.0696mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R43||R51/53:; |
| Biztonsági Leírás | S24||S37||S61:; |
| MSDS | |