Chemindex > 22560-21-0
HU ▼
22560-21-0 Potassium triethylborohydride |
|
| termék neve | Potassium triethylborohydride |
| Angol név | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| MF | C6H16BK |
| Molekulatömeg | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| CAS-szám | 22560-21-0 |
| EINECS | 245-077-3 |
| Molekuláris szerkezete |  |
| Veszély szimbólumok |  F##Highly flammable||C##Corrosive:; |
| Kockázatot kódok | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| Biztonsági Leírás | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
-
Ha azt tervezi, hogy vegyi anyagokat szerez be Kínából, csak menjen a ChemNet bevásárlóközpontba, mi megkapjuk a legújabb és versenyképes árat a kínai gyártóktól az Ön számára.Kérjük, látogasson el a
ChemNet Mall
oldalra.
A kémiai CAS adatbázis szolgáltatást a ChemIndex.com nyújtja 