ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
260-94-6 Acridine | 
    |
| termék neve | Acridine | 
| Angol név | Acridine;Dibenzo[b,e]pyridine | 
| MF | C13H9N | 
| Molekulatömeg | 179.2173 | 
| InChI | InChI=1/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H | 
| CAS-szám | 260-94-6 | 
| EINECS | 205-971-6 | 
| Molekuláris szerkezete | ![]()  | 
    
| Sűrűség | 1.187g/cm3 | 
| Olvadáspont | 105-110℃ | 
| Forráspont | 346.7°C at 760 mmHg | 
| Törésmutató | 1.726 | 
| Gyulladáspont | 153.8°C | 
| Gőznyomás | 0.000113mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
    
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
    
| MSDS | |