ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38939-88-7 3-Chloro-4-nitrotoluene |
|
termék neve | 3-Chloro-4-nitrotoluene |
Angol név | 3-Chloro-4-nitrotoluene;2-chloro-4-methyl-1-nitrobenzene |
MF | C7H6ClNO2 |
Molekulatömeg | 171.581 |
InChI | InChI=1/C7H6ClNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
CAS-szám | 38939-88-7 |
EINECS | 254-199-6 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.324g/cm3 |
Olvadáspont | 22-27℃ |
Forráspont | 273.4°C at 760 mmHg |
Törésmutató | 1.57 |
Gyulladáspont | 119.1°C |
Gőznyomás | 0.00962mmHg at 25°C |
Veszély szimbólumok | |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |