ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42779-10-2 Izobutil-tioetanol |
|
| termék neve | Izobutil-tioetanol |
| Szinonimák | ; 2-(izobutil-szulfanil)etanol; 2-hidroxietil-izobutil-szulfid; etanol, 2-[(2-metilpropil)tio]-; 2-[(2-metilpropil)szulfanil]etanol; |
| Angol név | Isobutylthioethanol;2-(Isobutylsulfanyl)ethanol;2-Hydroxyethyl isobutyl sulfide;ethanol, 2-[(2-methylpropyl)thio]-;2-[(2-methylpropyl)sulfanyl]ethanol |
| MF | C6H14OS |
| Molekulatömeg | 134.2398 |
| InChI | InChI=1/C6H14OS/c1-6(2)5-8-4-3-7/h6-7H,3-5H2,1-2H3 |
| CAS-szám | 42779-10-2 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.962g/cm3 |
| Forráspont | 211°C at 760 mmHg |
| Törésmutató | 1.476 |
| Gyulladáspont | 103.4°C |
| Gőznyomás | 0.0422mmHg at 25°C |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Biztonsági Leírás | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |