ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
497-03-0 2-methyl-2-butenal |
|
| termék neve | 2-methyl-2-butenal |
| Angol név | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
| MF | C5H8O |
| Molekulatömeg | 84.11 |
| InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
| CAS-szám | 497-03-0 |
| EINECS | 207-833-0 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 0.871 |
| Forráspont | 115-118℃ (752 torr) |
| Törésmutató | 1.447 |
| Gyulladáspont | 18℃ |
| Veszély szimbólumok | |
| Kockázatot kódok | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Biztonsági Leírás | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |