ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50-66-8 6-(Methylthio)purine |
|
| termék neve | 6-(Methylthio)purine |
| Angol név | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
| MF | C6H6N4S |
| Molekulatömeg | 166.2036 |
| InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
| CAS-szám | 50-66-8 |
| EINECS | 200-057-3 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.59g/cm3 |
| Olvadáspont | 221-222℃ |
| Forráspont | 290.9°C at 760 mmHg |
| Törésmutató | 1.806 |
| Gyulladáspont | 129.7°C |
| Gőznyomás | 0.00351mmHg at 25°C |
| Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |