ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59-82-5 5-Nitro-2-furonitrile |
|
| termék neve | 5-Nitro-2-furonitrile |
| Angol név | 5-Nitro-2-furonitrile;5-Nitro-2-furancarbonitrile;5-nitrofuran-2-carbonitrile |
| MF | C5H2N2O3 |
| Molekulatömeg | 138.081 |
| InChI | InChI=1/C5H2N2O3/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS-szám | 59-82-5 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.46g/cm3 |
| Forráspont | 234.7°C at 760 mmHg |
| Törésmutató | 1.544 |
| Gyulladáspont | 95.7°C |
| Gőznyomás | 0.0522mmHg at 25°C |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |