ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71642-16-5 3-Methyl-2,4,6-tribromoaniline |
|
termék neve | 3-Methyl-2,4,6-tribromoaniline |
Angol név | 3-Methyl-2,4,6-tribromoaniline;2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine;2,4,6-Tribromo-m-toluidine;2,4,6-tribromo-3-methylaniline |
MF | C7H6Br3N |
Molekulatömeg | 343.8412 |
InChI | InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
CAS-szám | 71642-16-5 |
Molekuláris szerkezete | ![]() |
Sűrűség | 2.196g/cm3 |
Olvadáspont | 101-102℃ |
Forráspont | 314.1°C at 760 mmHg |
Törésmutató | 1.668 |
Gyulladáspont | 143.8°C |
Gőznyomás | 0.000475mmHg at 25°C |
Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Biztonsági Leírás | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |