ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75-27-4 Bromodichloromethane |
|
| termék neve | Bromodichloromethane |
| Angol név | Bromodichloromethane;FC-20B1 |
| MF | CHBrCl2 |
| Molekulatömeg | 163.8286 |
| InChI | InChI=1/CHBrCl2/c2-1(3)4/h1H |
| CAS-szám | 75-27-4 |
| EINECS | 200-856-7 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 2.013g/cm3 |
| Olvadáspont | -55℃ |
| Forráspont | 89.7°C at 760 mmHg |
| Törésmutató | 1.503 |
| Gyulladáspont | 1.3°C |
| Gőznyomás | 65.3mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R22##Harmful if swallowed.||R40##Possible risks of irreversible effects.:; |
| Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |