ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
830-03-5 4-Nitrophenyl acetate |
|
termék neve | 4-Nitrophenyl acetate |
Angol név | 4-Nitrophenyl acetate;Acetic acid 4-nitrophenyl ester;p-Nitrophenol acetate |
MF | C8H7NO4 |
Molekulatömeg | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
CAS-szám | 830-03-5 |
EINECS | 212-593-5 |
Molekuláris szerkezete | ![]() |
Sűrűség | 1.304g/cm3 |
Olvadáspont | 76-79℃ |
Forráspont | 296.8°C at 760 mmHg |
Törésmutató | 1.548 |
Gyulladáspont | 145.2°C |
Gőznyomás | 0.0014mmHg at 25°C |
Biztonsági Leírás | S24/25##Avoid contact with skin and eyes.:; |
MSDS |