ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
92-32-0 Pyronin Y |
|
| termék neve | Pyronin Y |
| Angol név | Pyronin Y;C.I. 45005;Pyronine;Pyronin G;PYRONINE G;pyronin Y molecular biology;Pyronin Y, CI 45005;Pyronine Y;N-[6-(dimethylamino)-3H-xanthen-3-ylidene]-N-methylmethanaminium chloride |
| MF | C17H19ClN2O |
| Molekulatömeg | 302.7986 |
| InChI | InChI=1/C17H19N2O.ClH/c1-18(2)14-7-5-12-9-13-6-8-15(19(3)4)11-17(13)20-16(12)10-14;/h5-11H,1-4H3;1H/q+1;/p-1 |
| CAS-szám | 92-32-0 |
| EINECS | 202-147-8 |
| Molekuláris szerkezete | ![]() |
| Olvadáspont | 250-260℃ |
| Veszély szimbólumok | |
| Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |