ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
10401-11-3 3-Hydroxyphenylacetylene |
|
Nama produk | 3-Hydroxyphenylacetylene |
Nama bahasa Inggris | 3-Hydroxyphenylacetylene;3-Ethynylphenol |
MF | C8H6O |
Berat Molekul | 118.1326 |
InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS NO | 10401-11-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.12g/cm3 |
Titik didih | 230.9°C at 760 mmHg |
Indeks bias | 1.589 |
Titik nyala | 106.1°C |
Tekanan uap | 0.0424mmHg at 25°C |
Kode Risiko | R36/38##Irritating to eyes and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |