ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
17969-22-1 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
|
Nama produk | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole |
Nama bahasa Inggris | 4-(chloromethyl)-2-(4-chlorophenyl)-1,3-thiazole; |
MF | C10H7Cl2NS |
Berat Molekul | 244.1403 |
InChI | InChI=1/C10H7Cl2NS/c11-5-9-6-14-10(13-9)7-1-3-8(12)4-2-7/h1-4,6H,5H2 |
CAS NO | 17969-22-1 |
Struktur Molekul | ![]() |
Kepadatan | 1.378g/cm3 |
Titik lebur | 78℃ |
Titik didih | 374°C at 760 mmHg |
Indeks bias | 1.617 |
Titik nyala | 180°C |
Tekanan uap | 1.85E-05mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |