ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
20028-53-9 2-Amino-5-chlorobenzaldehyde |
|
Nama produk | 2-Amino-5-chlorobenzaldehyde |
Nama bahasa Inggris | 2-Amino-5-chlorobenzaldehyde;6-Amino-3-chlorobenzaldehyde |
MF | C7H6ClNO |
Berat Molekul | 155.5816 |
InChI | InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
CAS NO | 20028-53-9 |
Struktur Molekul | ![]() |
Kepadatan | 1.348g/cm3 |
Titik didih | 288.1°C at 760 mmHg |
Indeks bias | 1.651 |
Titik nyala | 128°C |
Tekanan uap | 0.00239mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |