ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
207986-25-2 alpha-Bromo-4-(diethylamino)acetophenone |
|
Nama produk | alpha-Bromo-4-(diethylamino)acetophenone |
Nama bahasa Inggris | alpha-Bromo-4-(diethylamino)acetophenone;4-(Diethylamino)phenacyl bromide;2-bromo-1-[4-(diethylamino)phenyl]ethanone |
MF | C12H16BrNO |
Berat Molekul | 270.1655 |
InChI | InChI=1/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 |
CAS NO | 207986-25-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.316g/cm3 |
Titik didih | 357.7°C at 760 mmHg |
Indeks bias | 1.572 |
Titik nyala | 170.1°C |
Tekanan uap | 2.69E-05mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |