Chemindex > 22560-21-0
ID ▼
22560-21-0 Potassium triethylborohydride |
|
| Nama produk | Potassium triethylborohydride |
| Nama bahasa Inggris | Potassium triethylborohydride;potassium triethylhydroborate;potassium triethyl(hydrido)borate(1-);Potassium hydrotriethylborate |
| MF | C6H16BK |
| Berat Molekul | 138.1005 |
| InChI | InChI=1/C6H16B.K/c1-4-7(5-2)6-3;/h7H,4-6H2,1-3H3;/q-1;+1 |
| CAS NO | 22560-21-0 |
| EINECS | 245-077-3 |
| Struktur Molekul |  |
| Simbol bahaya |  F##Highly flammable||C##Corrosive:; |
| Kode Risiko | R11##Highly flammable.||R15##Contact with water liberates highly flammable gases.||R19##May form explosive peroxides.||R34##Causes burns.:; |
| Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S7/8##Keep container tightly closed and dry.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 