ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
25952-74-3 3,5-dibromo-4-hidroksibenzaldehida oksim |
|
Nama produk | 3,5-dibromo-4-hidroksibenzaldehida oksim |
Sinonim | 2,6-dibromo-4-[(E)-(hydroxyimino)metil]fenol; |
Nama bahasa Inggris | 3,5-dibromo-4-hydroxybenzaldehyde oxime;2,6-dibromo-4-[(E)-(hydroxyimino)methyl]phenol |
MF | C7H5Br2NO2 |
Berat Molekul | 294.9281 |
InChI | InChI=1/C7H5Br2NO2/c8-5-1-4(3-10-12)2-6(9)7(5)11/h1-3,11-12H/b10-3+ |
CAS NO | 25952-74-3 |
Struktur Molekul | ![]() |
Kepadatan | 2.091g/cm3 |
Titik lebur | 198℃ |
Titik didih | 311.907°C at 760 mmHg |
Indeks bias | 1.661 |
Titik nyala | 142.436°C |
Tekanan uap | 0mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |