ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-53-3 Iodoacetic acid, sodium salt |
|
| Nama produk | Iodoacetic acid, sodium salt |
| Nama bahasa Inggris | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
| MF | C2H2INaO2 |
| Berat Molekul | 207.9303 |
| InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
| CAS NO | 305-53-3 |
| EINECS | 206-165-7 |
| Struktur Molekul | ![]() |
| Titik lebur | 208-210℃ |
| Titik didih | 262.1°C at 760 mmHg |
| Titik nyala | 112.3°C |
| Tekanan uap | 0.00329mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |