ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
| Nama produk | 2-fluorobenzal chloride |
| Nama bahasa Inggris | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
| MF | C7H5Cl2F |
| Berat Molekul | 179.02 |
| InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| CAS NO | 320-65-0 |
| EINECS | 206-279-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.3 |
| Titik didih | 224℃ |
| Kode Risiko | R34##Causes burns.||R36##Irritating to eyes.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |