ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32025-65-3 3-Methoxyphenylglyoxal hydrate |
|
Nama produk | 3-Methoxyphenylglyoxal hydrate |
Nama bahasa Inggris | 3-Methoxyphenylglyoxal hydrate;3-Methoxyphenylglyoxal;AI3-25049;meta-Methoxyphenylglyoxal;Benzeneacetaldehyde, 3-methoxy-alpha-oxo-, hemihydrate;(3-methoxyphenyl)(oxo)acetaldehyde |
MF | C9H8O3 |
Berat Molekul | 164.158 |
InChI | InChI=1/C9H8O3/c1-12-8-4-2-3-7(5-8)9(11)6-10/h2-6H,1H3 |
CAS NO | 32025-65-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.153g/cm3 |
Titik didih | 264.3°C at 760 mmHg |
Indeks bias | 1.518 |
Titik nyala | 113.5°C |
Tekanan uap | 0.00981mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |