ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone |
|
Nama produk | 3',5'-dichloro-2'-hydroxyacetophenone |
Nama bahasa Inggris | 3',5'-dichloro-2'-hydroxyacetophenone;3,5-Dichloro-2-hydroxyacetophenone;1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
MF | C8H6Cl2O2 |
Berat Molekul | 205.038 |
InChI | InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
CAS NO | 3321-92-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.43g/cm3 |
Titik lebur | 94-97℃ |
Titik didih | 295.6°C at 760 mmHg |
Indeks bias | 1.583 |
Titik nyala | 132.6°C |
Tekanan uap | 0.000856mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |