ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3407-83-8 (2-nitrofenil) (okso)arsane |
|
| Nama produk | (2-nitrofenil) (okso)arsane |
| Sinonim | ; |
| Nama bahasa Inggris | (2-nitrophenyl)(oxo)arsane; |
| MF | C6H4AsNO3 |
| Berat Molekul | 213.0225 |
| InChI | InChI=1/C6H4AsNO3/c9-7-5-3-1-2-4-6(5)8(10)11/h1-4H |
| CAS NO | 3407-83-8 |
| Struktur Molekul | ![]() |
| MSDS | |