ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3440-24-2 3',4',7,8-tetrahidroksiflavon |
|
Nama produk | 3',4',7,8-tetrahidroksiflavon |
Sinonim | 2- (3,4-dihidroksifenil) -7,8-dihidroksi-4H-krom-4-satu; |
Nama bahasa Inggris | 3',4',7,8-Tetrahydroxyflavone;2-(3,4-dihydroxyphenyl)-7,8-dihydroxy-4H-chromen-4-one |
MF | C15H10O6 |
Berat Molekul | 286.2363 |
InChI | InChI=1/C15H10O6/c16-9-3-1-7(5-12(9)19)13-6-11(18)8-2-4-10(17)14(20)15(8)21-13/h1-6,16-17,19-20H |
CAS NO | 3440-24-2 |
Struktur Molekul | ![]() |
Kepadatan | 1.654g/cm3 |
Titik didih | 618.9°C at 760 mmHg |
Indeks bias | 1.767 |
Titik nyala | 240.6°C |
Tekanan uap | 6.57E-16mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |