ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39652-32-9 3-Chloro-4-methylbenzyl alcohol |
|
| Nama produk | 3-Chloro-4-methylbenzyl alcohol |
| Nama bahasa Inggris | 3-Chloro-4-methylbenzyl alcohol;3-Chloro-4-methylbenzyl Alcohol, Tech.;(3-chloro-4-methylphenyl)methanol |
| MF | C8H9ClO |
| Berat Molekul | 156.6095 |
| InChI | InChI=1/C8H9ClO/c1-6-2-3-7(5-10)4-8(6)9/h2-4,10H,5H2,1H3 |
| CAS NO | 39652-32-9 |
| EINECS | 254-566-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.191g/cm3 |
| Titik didih | 252.1°C at 760 mmHg |
| Indeks bias | 1.558 |
| Titik nyala | 106.3°C |
| Tekanan uap | 0.0103mmHg at 25°C |
| MSDS | |