ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42779-10-2 Isobutylthioethanol |
|
| Nama produk | Isobutylthioethanol |
| Sinonim | ; 2- (Isobutylsulfanyl) etanol; 2-Hidroksietil isobutil sulfida; etanol, 2-[(2-metilpropil)thio]-; 2- [(2-metilpropil) sulfanil] etanol; |
| Nama bahasa Inggris | Isobutylthioethanol;2-(Isobutylsulfanyl)ethanol;2-Hydroxyethyl isobutyl sulfide;ethanol, 2-[(2-methylpropyl)thio]-;2-[(2-methylpropyl)sulfanyl]ethanol |
| MF | C6H14OS |
| Berat Molekul | 134.2398 |
| InChI | InChI=1/C6H14OS/c1-6(2)5-8-4-3-7/h6-7H,3-5H2,1-2H3 |
| CAS NO | 42779-10-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.962g/cm3 |
| Titik didih | 211°C at 760 mmHg |
| Indeks bias | 1.476 |
| Titik nyala | 103.4°C |
| Tekanan uap | 0.0422mmHg at 25°C |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Deskripsi | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |