ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-05-9 1-(3-fluorophenyl)-2-thiourea |
|
| Nama produk | 1-(3-fluorophenyl)-2-thiourea |
| Nama bahasa Inggris | 1-(3-fluorophenyl)-2-thiourea;3-Fluorophenylthiourea;1-(3-fluorophenyl)thiourea |
| MF | C7H7FN2S |
| Berat Molekul | 170.2073 |
| InChI | InChI=1/C7H7FN2S/c8-5-2-1-3-6(4-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| CAS NO | 458-05-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.397g/cm3 |
| Titik didih | 259.3°C at 760 mmHg |
| Indeks bias | 1.692 |
| Titik nyala | 110.6°C |
| Tekanan uap | 0.0131mmHg at 25°C |
| Kode Risiko | R25##Toxic if swallowed.:; |
| Keselamatan Deskripsi | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |