ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
497-03-0 2-methyl-2-butenal |
|
Nama produk | 2-methyl-2-butenal |
Nama bahasa Inggris | 2-methyl-2-butenal;Methylbutenal;tiglaldehyde;guaiol;2-Methylcrotonaldehyde~Tiglic aldehyde |
MF | C5H8O |
Berat Molekul | 84.11 |
InChI | InChI=1/C5H8O/c1-3-5(2)4-6/h3-4H,1-2H3/b5-3+ |
CAS NO | 497-03-0 |
EINECS | 207-833-0 |
Struktur Molekul | ![]() |
Kepadatan | 0.871 |
Titik didih | 115-118℃ (752 torr) |
Indeks bias | 1.447 |
Titik nyala | 18℃ |
Simbol bahaya | |
Kode Risiko | R11##Highly flammable.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |