ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5762-27-6 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
|
| Nama produk | 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
| Nama bahasa Inggris | 1-oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid;1H-2-Benzopyran-3-carboxylic acid, 3,4-dihydro-1-oxo-;1-Oxo-3,4-dihydro-1H-isochromene-3-carboxylic acid |
| MF | C10H8O4 |
| Berat Molekul | 192.1681 |
| InChI | InChI=1/C10H8O4/c11-9(12)8-5-6-3-1-2-4-7(6)10(13)14-8/h1-4,8H,5H2,(H,11,12) |
| CAS NO | 5762-27-6 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.412g/cm3 |
| Titik didih | 471.5°C at 760 mmHg |
| Indeks bias | 1.595 |
| Titik nyala | 197.6°C |
| Tekanan uap | 1.07E-09mmHg at 25°C |
| MSDS | |