ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-55-9 4-Heptanol |
|
| Nama produk | 4-Heptanol |
| Nama bahasa Inggris | 4-Heptanol;Dipropylcarbinol;heptan-4-ol |
| MF | C7H16O |
| Berat Molekul | 116.2013 |
| InChI | InChI=1/C7H16O/c1-3-5-7(8)6-4-2/h7-8H,3-6H2,1-2H3 |
| CAS NO | 589-55-9 |
| EINECS | 209-651-7 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.818g/cm3 |
| Titik didih | 161.3°C at 760 mmHg |
| Indeks bias | 1.42 |
| Titik nyala | 61.8°C |
| Tekanan uap | 0.792mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R10##Flammable.||R36##Irritating to eyes.:; |
| Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
| MSDS | |