ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-98-0 3-Octanol |
|
Nama produk | 3-Octanol |
Nama bahasa Inggris | 3-Octanol;DL-3-Octanol;ethylpentylcarbinol;n-Amyl ethyl carbinol;Ethyl n-pentyl carbinol;(3S)-octan-3-ol;(±)-octan-3-ol;(3R)-octan-3-ol |
MF | C8H18O |
Berat Molekul | 130.2279 |
InChI | InChI=1/C8H18O/c1-3-5-6-7-8(9)4-2/h8-9H,3-7H2,1-2H3/t8-/m0/s1 |
CAS NO | 589-98-0;20296-29-1 |
EINECS | 209-667-4 |
Struktur Molekul | ![]() |
Kepadatan | 0.821g/cm3 |
Titik lebur | -45℃ |
Titik didih | 169°C at 760 mmHg |
Indeks bias | 1.426 |
Titik nyala | 65.6°C |
Tekanan uap | 0.512mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |