Chemindex > 5989-27-5
ID ▼
5989-27-5 (+)-Limonene |
|
| Nama produk | (+)-Limonene |
| Nama bahasa Inggris | (+)-Limonene;D-Limonene;Limonene 145;(R)-p-mentha-1,8-diene;(R)-(+)-4-Isopropenyl-1-methylcyclohexene;(+)-p-Mentha-1,8-diene;(4R)-1-methyl-4-(prop-1-en-2-yl)cyclohexene |
| MF | C10H16 |
| Berat Molekul | 136.234 |
| InChI | InChI=1/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| CAS NO | 5989-27-5 |
| EINECS | 227-813-5 |
| Struktur Molekul |  |
| Kepadatan | 0.834g/cm3 |
| Titik lebur | -74℃ |
| Titik didih | 175.4°C at 760 mmHg |
| Indeks bias | 1.467 |
| Titik nyala | 42.8°C |
| Tekanan uap | 1.54mmHg at 25°C |
| Simbol bahaya |  Xi##Irritant||N##Dangerous for the environment:; |
| Kode Risiko | R10##Flammable.||R38##Irritating to skin.||R43##May cause sensitization by skin contact.||R50/53##Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Keselamatan Deskripsi | S24##Avoid contact with skin.||S37##Wear suitable gloves.||S60##This material and its container must be disposed of as hazardous waste.||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 