ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
623-37-0 3-Hexanol |
|
| Nama produk | 3-Hexanol |
| Nama bahasa Inggris | 3-Hexanol;3-Hexyl alcohol;Ethyl propyl carbinol;FEMA No. 3351;NSC 60708;hexan-3-ol;(3S)-hexan-3-ol;(3R)-hexan-3-ol |
| MF | C6H14O |
| Berat Molekul | 102.1748 |
| InChI | InChI=1/C6H14O/c1-3-5-6(7)4-2/h6-7H,3-5H2,1-2H3/t6-/m1/s1 |
| CAS NO | 623-37-0 |
| EINECS | 210-790-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 0.814g/cm3 |
| Titik didih | 135°C at 760 mmHg |
| Indeks bias | 1.413 |
| Titik nyala | 41.7°C |
| Tekanan uap | 3.39mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R10##Flammable.||R22##Harmful if swallowed.:; |
| Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |