Chemindex > 62524-21-4
ID ▼
62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide |
|
| Nama produk | 3-chlorobenzo[b]thiophene-2-carbohydrazide |
| Nama bahasa Inggris | 3-chlorobenzo[b]thiophene-2-carbohydrazide;3-chloro-1-benzothiophene-2-carbohydrazide;3-Chlorobenzothiophene-2-carboxylic acid hydrazide |
| MF | C9H7ClN2OS |
| Berat Molekul | 226.6827 |
| InChI | InChI=1/C9H7ClN2OS/c10-7-5-3-1-2-4-6(5)14-8(7)9(13)12-11/h1-4H,11H2,(H,12,13) |
| CAS NO | 62524-21-4 |
| Struktur Molekul | ![62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide](https://images-a.chemnet.com/suppliers/chembase/132/13230.gif "62524-21-4 3-chlorobenzo[b]thiophene-2-carbohydrazide") |
| Kepadatan | 1.486g/cm3 |
| Titik lebur | 181℃ |
| Indeks bias | 1.714 |
| Simbol bahaya |  Xi##Irritant:; |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 62524-21-4 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 