ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6505-48-2 2,4-dikloro-6-{[(2-morfolin-4-ylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one |
|
| Nama produk | 2,4-dikloro-6-{[(2-morfolin-4-ylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one |
| Sinonim | ; |
| Nama bahasa Inggris | 2,4-dichloro-6-{[(2-morpholin-4-ylphenyl)amino]methylidene}cyclohexa-2,4-dien-1-one; |
| MF | C17H16Cl2N2O2 |
| Berat Molekul | 351.2271 |
| InChI | InChI=1/C17H16Cl2N2O2/c18-13-9-12(17(22)14(19)10-13)11-20-15-3-1-2-4-16(15)21-5-7-23-8-6-21/h1-4,9-11,20H,5-8H2 |
| CAS NO | 6505-48-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.39g/cm3 |
| Titik didih | 448.7°C at 760 mmHg |
| Indeks bias | 1.648 |
| Titik nyala | 225.1°C |
| Tekanan uap | 3.04E-08mmHg at 25°C |
| MSDS | |