ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
700-96-9 3,4-Dimethoxythiophenol |
|
| Nama produk | 3,4-Dimethoxythiophenol |
| Nama bahasa Inggris | 3,4-Dimethoxythiophenol;3,4-Dimethoxybenzenethiol |
| MF | C8H10O2S |
| Berat Molekul | 170.22 |
| InChI | InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
| CAS NO | 700-96-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.19 |
| Titik didih | 110℃(1 torr) |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |