Chemindex > 70682-65-4
ID ▼
70682-65-4 O, O-bis (sec-butil) hidrogen dithiophosphate, senyawa dengan dicyclohexylamine (1: 1) |
|
| Nama produk | O, O-bis (sec-butil) hidrogen dithiophosphate, senyawa dengan dicyclohexylamine (1: 1) |
| Sinonim | Asam fosforoditioat, O, O-bis (1-metilpropil) ester, compd.dengan N-cyclohexylcyclohexanamine (1:1); O, O-Bis (1-metilpropil) dithiophosphate, garam dicyclohexylamine; O, O-Bis (sec-butil) hidrogen dithiophosphate, senyawa dengan dicyclohexylamine (1: 1); O,O-dibutan-2-yl hidrogen fosforodithioate - N-sikloheksilsikloheksanamin (1:1); |
| Nama bahasa Inggris | O,O-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);Phosphorodithioic acid, O,O-bis(1-methylpropyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1);O,O-Bis(1-methylpropyl) dithiophosphate, dicyclohexylamine salt;O,O-Bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);O,O-dibutan-2-yl hydrogen phosphorodithioate - N-cyclohexylcyclohexanamine (1:1) |
| MF | C20H42NO2PS2 |
| Berat Molekul | 423.6567 |
| InChI | InChI=1/C12H23N.C8H19O2PS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3)9-11(12,13)10-8(4)6-2/h11-13H,1-10H2;7-8H,5-6H2,1-4H3,(H,12,13) |
| CAS NO | 70682-65-4 |
| EINECS | 274-745-7 |
| Struktur Molekul |  |
| Titik didih | 256.1°C at 760 mmHg |
| Titik nyala | 96.1°C |
| Tekanan uap | 0.0157mmHg at 25°C |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 70682-65-4 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 