ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7623-11-2 2-Chlorobutyryl chloride |
|
| Nama produk | 2-Chlorobutyryl chloride |
| Nama bahasa Inggris | 2-Chlorobutyryl chloride;2-Chlorobutyryl chloride;2-chlorobutanoyl chloride |
| MF | C4H6Cl2O |
| Berat Molekul | 140.9958 |
| InChI | InChI=1/C4H6Cl2O/c1-2-3(5)4(6)7/h3H,2H2,1H3 |
| CAS NO | 7623-11-2 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.227g/cm3 |
| Titik didih | 130.5°C at 760 mmHg |
| Indeks bias | 1.44 |
| Titik nyala | 53.2°C |
| Tekanan uap | 9.68mmHg at 25°C |
| Kode Risiko | R34##Causes burns.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |