ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
842124-01-0 2- (2-kloro-6-fluorobenzyl) -1,3-dioxolane |
|
| Nama produk | 2- (2-kloro-6-fluorobenzyl) -1,3-dioxolane |
| Sinonim | ; 1,3-Dioksilan, 2-[(2-kloro-6-fluorofenil)metil]-; 2- (2-Chloro-6-fluorobenzyl) -1,3-dioxolane; |
| Nama bahasa Inggris | 2-(2-chloro-6-fluorobenzyl)-1,3-dioxolane;1,3-Dioxolane, 2-[(2-chloro-6-fluorophenyl)methyl]-;2-(2-Chloro-6-fluorobenzyl)-1,3-dioxolane |
| MF | C10H10ClFO2 |
| Berat Molekul | 216.6366 |
| InChI | InChI=1/C10H10ClFO2/c11-8-2-1-3-9(12)7(8)6-10-13-4-5-14-10/h1-3,10H,4-6H2 |
| CAS NO | 842124-01-0 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.31g/cm3 |
| Titik didih | 274°C at 760 mmHg |
| Indeks bias | 1.53 |
| Titik nyala | 119.5°C |
| Tekanan uap | 0.0093mmHg at 25°C |
| MSDS | |