ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
874-83-9 4-(2-Thienyl)-3-buten-2-one |
|
| Nama produk | 4-(2-Thienyl)-3-buten-2-one |
| Nama bahasa Inggris | 4-(2-Thienyl)-3-buten-2-one;3-buten-2-one, 4-(2-thienyl)-;4-(2-THIENYL)BUT-3-EN-2-ONE;4-(thiophen-2-yl)but-3-en-2-one;(Z)-4-(2-thienyl)but-3-en-2-one |
| MF | C8H8OS |
| Berat Molekul | 152.2135 |
| InChI | InChI=1/C8H8OS/c1-7(9)4-5-8-3-2-6-10-8/h2-6H,1H3/b5-4- |
| CAS NO | 874-83-9 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.14g/cm3 |
| Titik didih | 271.5°C at 760 mmHg |
| Indeks bias | 1.592 |
| Titik nyala | 118°C |
| Tekanan uap | 0.00643mmHg at 25°C |
| MSDS | |