ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
27813-02-1 2-Hydroxypropyl methacrylate, mixture of isomers |
|
| Nama produk | 2-Hydroxypropyl methacrylate, mixture of isomers |
| Nama bahasa Inggris | 2-Hydroxypropyl methacrylate, mixture of isomers;2-Hydroxypropyl methacrylate;methacrylic acid hydroxypropyl ester;Hydroxyethyl Methacrylate;PROPYLENE GLYCOL MONOMETHACRYLATE;beta.-Hydroxypropylmethacrylate;1,2-propanediol,2-methyl,monomethacrylate;1,2-propanediol,monomethacrylate;2-hydroxypropylmethacrylate,mixtureofisomers;2-methyl-2-propenoicaci2-hydroxymethylethylester;2-Propenoicacid,2-methyl-,monoesterwith1,2-propanediol;methacrylicacid,esterwith1,2-propanediol;2-Propenoic acid, 2-methyl-, 2-hydroxypropyl ester;Hydroxypropyl methacrylate;1-hydroxypropan-2-yl 2-methylprop-2-enoate;(2S)-2-hydroxypropyl 2-methylprop-2-enoate;(2R)-2-hydroxypropyl 2-methylprop-2-enoate;1-hydroxypropyl 2-methylprop-2-enoate;2-Hydroxypropylmethacrylate;Hydroxyproyl methacrylate |
| MF | C7H12O3 |
| Berat Molekul | 144.1684 |
| InChI | InChI=1/C7H12O3/c1-4-6(8)10-7(9)5(2)3/h6,8H,2,4H2,1,3H3 |
| CAS NO | 27813-02-1;923-26-2 |
| EINECS | 248-666-3;213-090-3 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.027g/cm3 |
| Titik didih | 196.065°C at 760 mmHg |
| Indeks bias | 1.444 |
| Titik nyala | 72.963°C |
| Tekanan uap | 0.105mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R36/37/38||R43:; |
| Keselamatan Deskripsi | S26||S36/37:; |
| MSDS | |