Chemindex > 937-41-7
ID ▼
937-41-7 Phenylacrylate |
|
| Nama produk | Phenylacrylate |
| Nama bahasa Inggris | Phenylacrylate;Phenyl acrylate, (Acrylic acid phenyl ester);Acrylic acid phenyl ester;Phenylacrylate Phenyl acrylate;Phenyl acrylate;phenyl prop-2-enoate |
| MF | C9H8O2 |
| Berat Molekul | 148.1586 |
| InChI | InChI=1/C9H8O2/c1-2-9(10)11-8-6-4-3-5-7-8/h2-7H,1H2 |
| CAS NO | 937-41-7 |
| EINECS | 213-329-1 |
| Struktur Molekul |  |
| Kepadatan | 1.068g/cm3 |
| Titik didih | 232.2°C at 760 mmHg |
| Indeks bias | 1.517 |
| Titik nyala | 88.3°C |
| Tekanan uap | 0.0596mmHg at 25°C |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S28##After contact with skin, wash immediately with plenty of ...||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 