ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
| שם המוצר | 2-fluorobenzal chloride |
| שם אנגלי | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
| מולקולרית פורמולה | C7H5Cl2F |
| משקל מולקולרי | 179.02 |
| InChl | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
| מספר CAS | 320-65-0 |
| EINECS | 206-279-7 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.3 |
| נקודת רתיחה | 224℃ |
| סיכונים קודי | R34##Causes burns.||R36##Irritating to eyes.:; |
| בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |