ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3321-92-4 3',5'-dichloro-2'-hydroxyacetophenone |
|
שם המוצר | 3',5'-dichloro-2'-hydroxyacetophenone |
שם אנגלי | 3',5'-dichloro-2'-hydroxyacetophenone;3,5-Dichloro-2-hydroxyacetophenone;1-(3,5-dichloro-2-hydroxyphenyl)ethanone |
מולקולרית פורמולה | C8H6Cl2O2 |
משקל מולקולרי | 205.038 |
InChl | InChI=1/C8H6Cl2O2/c1-4(11)6-2-5(9)3-7(10)8(6)12/h2-3,12H,1H3 |
מספר CAS | 3321-92-4 |
מבנה מולקולרי | ![]() |
צפיפות | 1.43g/cm3 |
נקודת ההתוך | 94-97℃ |
נקודת רתיחה | 295.6°C at 760 mmHg |
משקל סגולי | 1.583 |
נקודת הבזק | 132.6°C |
לחץ אדים | 0.000856mmHg at 25°C |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |