ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
36847-94-6 N-(2-Methoxyphenyl)maleamic acid |
|
שם המוצר | N-(2-Methoxyphenyl)maleamic acid |
שם אנגלי | N-(2-Methoxyphenyl)maleamic acid;(2Z)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoic acid;(2E)-4-[(2-methoxyphenyl)amino]-4-oxobut-2-enoate |
מולקולרית פורמולה | C11H10NO4 |
משקל מולקולרי | 220.2019 |
InChl | InChI=1/C11H11NO4/c1-16-9-5-3-2-4-8(9)12-10(13)6-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/p-1/b7-6+ |
מספר CAS | 36847-94-6 |
מבנה מולקולרי | ![]() |
נקודת רתיחה | 468.9°C at 760 mmHg |
נקודת הבזק | 237.4°C |
לחץ אדים | 1.35E-09mmHg at 25°C |
סיכונים קודי | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
בטיחות תיאור | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |