Chemindex > 453-11-2
IL ▼
453-11-2 1-Chloro-3-fluoro-2-propanol |
|
| שם המוצר | 1-Chloro-3-fluoro-2-propanol |
| שם אנגלי | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
| מולקולרית פורמולה | C3H6ClFO |
| משקל מולקולרי | 112.5305 |
| InChl | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| מספר CAS | 453-11-2 |
| מבנה מולקולרי |  |
| צפיפות | 1.212g/cm3 |
| נקודת רתיחה | 158.1°C at 760 mmHg |
| משקל סגולי | 1.399 |
| נקודת הבזק | 49.4°C |
| לחץ אדים | 0.951mmHg at 25°C |
| סיכונים קודי | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| בטיחות תיאור | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- אם אתם מתכננים מקור כימיקלים מסין, פשוט לכו לקניון ChemNet, נקבל את המחיר העדכני והתחרותי ביותר מיצרנים מסין עבורכם.אנא בקרו באתר
ChemNet Mall
ספקים עבור 453-11-2 (0):
שירות מסד הנתונים של CAS כימי מסופק ע& 