ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
459-05-2 1-(4-fluorophenyl)-2-thiourea |
|
| שם המוצר | 1-(4-fluorophenyl)-2-thiourea |
| שם אנגלי | 1-(4-fluorophenyl)-2-thiourea;4-Fluorophenylthiourea;1-(4-fluorophenyl)thiourea |
| מולקולרית פורמולה | C7H7FN2S |
| משקל מולקולרי | 170.2073 |
| InChl | InChI=1/C7H7FN2S/c8-5-1-3-6(4-2-5)10-7(9)11/h1-4H,(H3,9,10,11) |
| מספר CAS | 459-05-2 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.397g/cm3 |
| נקודת ההתוך | 164℃ |
| נקודת רתיחה | 264.2°C at 760 mmHg |
| משקל סגולי | 1.692 |
| נקודת הבזק | 113.6°C |
| לחץ אדים | 0.00987mmHg at 25°C |
| סיכונים קודי | R25##Toxic if swallowed.:; |
| בטיחות תיאור | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |