ChemIndex - מאגר מידע CAS כימי חינמיToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50508-60-6 (2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone |
|
| שם המוצר | (2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone |
| שם אנגלי | (2-amino-5-ethylthiophen-3-yl)(2-chlorophenyl)methanone;(2-Amino-5-ethyl-3-thienyl)(2-chlorophenyl)methanone;methanone, (2-amino-5-ethyl-3-thienyl)(2-chlorophenyl)-;2-Amino-3-(2-chlorobenzoyl)-5-ethylthiophene;2-Amino-3-o-chlorobenzoyl-5-ethylthiophene |
| מולקולרית פורמולה | C13H12ClNOS |
| משקל מולקולרי | 265.7585 |
| InChl | InChI=1/C13H12ClNOS/c1-2-8-7-10(13(15)17-8)12(16)9-5-3-4-6-11(9)14/h3-7H,2,15H2,1H3 |
| מספר CAS | 50508-60-6 |
| מבנה מולקולרי | ![]() |
| צפיפות | 1.302g/cm3 |
| נקודת רתיחה | 454.8°C at 760 mmHg |
| משקל סגולי | 1.635 |
| נקודת הבזק | 228.9°C |
| לחץ אדים | 1.85E-08mmHg at 25°C |
| MSDS | |